C12H13BrClN3O2 — CID 106240670
2-[2-[5-bromo-2-(chloromethyl)benzimidazol-1-yl]ethoxy]acetamide (PubChem CID 106240670) has the molecular formula C12H13BrClN3O2 and a molecular weight of 346.61 g/mol. Its IUPAC name is 2-[2-[5-bromo-2-(chloromethyl)benzimidazol-1-yl]ethoxy]acetamide.
| Compound Name | 2-[2-[5-bromo-2-(chloromethyl)benzimidazol-1-yl]ethoxy]acetamide |
|---|---|
| PubChem CID | 106240670 |
| Molecular Formula | C12H13BrClN3O2 |
| Molecular Weight | 346.61 g/mol |
| Exact Mass | 344.99 |
| IUPAC Name | 2-[2-[5-bromo-2-(chloromethyl)benzimidazol-1-yl]ethoxy]acetamide |
| SMILES | NC(=O)COCCn1c(CCl)nc2cc(Br)ccc21 |
| InChI | InChI=1S/C12H13BrClN3O2/c13-8-1-2-10-9(5-8)16-12(6-14)17(10)3-4-19-7-11(15)18/h1-2,5H,3-4,6-7H2,(H2,15,18) |
| InChIKey | HWTRKDNTPIQVHJ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.61 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|