C14H16N3O4P — CID 25029959
[5-[1-(2-methylpropyl)imidazo[4,5-c]pyridin-2-yl]furan-2-yl]phosphonic acid (PubChem CID 25029959) has the molecular formula C14H16N3O4P and a molecular weight of 321.27 g/mol. Its IUPAC name is [5-[1-(2-methylpropyl)imidazo[4,5-c]pyridin-2-yl]furan-2-yl]phosphonic acid.
| Compound Name | [5-[1-(2-methylpropyl)imidazo[4,5-c]pyridin-2-yl]furan-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 25029959 |
| Molecular Formula | C14H16N3O4P |
| Molecular Weight | 321.27 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | [5-[1-(2-methylpropyl)imidazo[4,5-c]pyridin-2-yl]furan-2-yl]phosphonic acid |
| SMILES | CC(C)Cn1c(-c2ccc(P(=O)(O)O)o2)nc2cnccc21 |
| InChI | InChI=1S/C14H16N3O4P/c1-9(2)8-17-11-5-6-15-7-10(11)16-14(17)12-3-4-13(21-12)22(18,19)20/h3-7,9H,8H2,1-2H3,(H2,18,19,20) |
| InChIKey | GZGWOJOEVYIUEC-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.27 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|