C16H12N3O4P — CID 22459942
[5-(1-pyridin-4-ylbenzimidazol-2-yl)furan-2-yl]phosphonic acid (PubChem CID 22459942) has the molecular formula C16H12N3O4P and a molecular weight of 341.26 g/mol. Its IUPAC name is [5-(1-pyridin-4-ylbenzimidazol-2-yl)furan-2-yl]phosphonic acid.
| Compound Name | [5-(1-pyridin-4-ylbenzimidazol-2-yl)furan-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 22459942 |
| Molecular Formula | C16H12N3O4P |
| Molecular Weight | 341.26 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | [5-(1-pyridin-4-ylbenzimidazol-2-yl)furan-2-yl]phosphonic acid |
| SMILES | O=P(O)(O)c1ccc(-c2nc3ccccc3n2-c2ccncc2)o1 |
| InChI | InChI=1S/C16H12N3O4P/c20-24(21,22)15-6-5-14(23-15)16-18-12-3-1-2-4-13(12)19(16)11-7-9-17-10-8-11/h1-10H,(H2,20,21,22) |
| InChIKey | OHKIZAXKPCRBKZ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.26 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|