C33H22N6 — CID 155173998
2-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1-pyridin-4-ylbenzimidazole (PubChem CID 155173998) has the molecular formula C33H22N6 and a molecular weight of 502.58 g/mol. Its IUPAC name is 2-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1-pyridin-4-ylbenzimidazole.
| Compound Name | 2-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1-pyridin-4-ylbenzimidazole |
|---|---|
| PubChem CID | 155173998 |
| Molecular Formula | C33H22N6 |
| Molecular Weight | 502.58 g/mol |
| Exact Mass | 502.19 |
| IUPAC Name | 2-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1-pyridin-4-ylbenzimidazole |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc(-c4nc5ccccc5n4-c4ccncc4)cc3)n2)cc1 |
| InChI | InChI=1S/C33H22N6/c1-3-9-23(10-4-1)30-36-31(24-11-5-2-6-12-24)38-32(37-30)25-15-17-26(18-16-25)33-35-28-13-7-8-14-29(28)39(33)27-19-21-34-22-20-27/h1-22H |
| InChIKey | TXUISTJXHMTING-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.58 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |