C49H32N8 — CID 155179256
1-[3,5-bis(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2-phenylbenzimidazole (PubChem CID 155179256) has the molecular formula C49H32N8 and a molecular weight of 732.85 g/mol. Its IUPAC name is 1-[3,5-bis(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2-phenylbenzimidazole.
| Compound Name | 1-[3,5-bis(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2-phenylbenzimidazole |
|---|---|
| PubChem CID | 155179256 |
| Molecular Formula | C49H32N8 |
| Molecular Weight | 732.85 g/mol |
| Exact Mass | 732.27 |
| IUPAC Name | 1-[3,5-bis(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2-phenylbenzimidazole |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3cc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)cc(-n4c(-c5ccccc5)nc5ccccc54)c3)n2)cc1 |
| InChI | InChI=1S/C49H32N8/c1-6-18-33(19-7-1)43-51-44(34-20-8-2-9-21-34)54-47(53-43)38-30-39(48-55-45(35-22-10-3-11-23-35)52-46(56-48)36-24-12-4-13-25-36)32-40(31-38)57-42-29-17-16-28-41(42)50-49(57)37-26-14-5-15-27-37/h1-32H |
| InChIKey | WYTSTQAJTLUZPX-UHFFFAOYSA-N |
| XLogP | 11.06 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.85 |
| LogP ≤ 5 | 11.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |