C40H27N5 — CID 155173937
2-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1-(3-phenylphenyl)benzimidazole (PubChem CID 155173937) has the molecular formula C40H27N5 and a molecular weight of 577.69 g/mol. Its IUPAC name is 2-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1-(3-phenylphenyl)benzimidazole.
| Compound Name | 2-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1-(3-phenylphenyl)benzimidazole |
|---|---|
| PubChem CID | 155173937 |
| Molecular Formula | C40H27N5 |
| Molecular Weight | 577.69 g/mol |
| Exact Mass | 577.23 |
| IUPAC Name | 2-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1-(3-phenylphenyl)benzimidazole |
| SMILES | c1ccc(-c2cccc(-n3c(-c4cccc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)c4)nc4ccccc43)c2)cc1 |
| InChI | InChI=1S/C40H27N5/c1-4-14-28(15-5-1)31-20-13-23-34(27-31)45-36-25-11-10-24-35(36)41-40(45)33-22-12-21-32(26-33)39-43-37(29-16-6-2-7-17-29)42-38(44-39)30-18-8-3-9-19-30/h1-27H |
| InChIKey | RNYOJDLILFXBNG-UHFFFAOYSA-N |
| XLogP | 9.55 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.69 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |