C52H36N6 — CID 170034469
4-[4-[3-[4-phenyl-6-[3-[3-(2-phenylbenzimidazol-1-yl)phenyl]phenyl]-1,3,5-triazin-2-yl]phenyl]phenyl]aniline (PubChem CID 170034469) has the molecular formula C52H36N6 and a molecular weight of 744.90 g/mol. Its IUPAC name is 4-[4-[3-[4-phenyl-6-[3-[3-(2-phenylbenzimidazol-1-yl)phenyl]phenyl]-1,3,5-triazin-2-yl]phenyl]phenyl]aniline.
| Compound Name | 4-[4-[3-[4-phenyl-6-[3-[3-(2-phenylbenzimidazol-1-yl)phenyl]phenyl]-1,3,5-triazin-2-yl]phenyl]phenyl]aniline |
|---|---|
| PubChem CID | 170034469 |
| Molecular Formula | C52H36N6 |
| Molecular Weight | 744.90 g/mol |
| Exact Mass | 744.30 |
| IUPAC Name | 4-[4-[3-[4-phenyl-6-[3-[3-(2-phenylbenzimidazol-1-yl)phenyl]phenyl]-1,3,5-triazin-2-yl]phenyl]phenyl]aniline |
| SMILES | Nc1ccc(-c2ccc(-c3cccc(-c4nc(-c5ccccc5)nc(-c5cccc(-c6cccc(-n7c(-c8ccccc8)nc8ccccc87)c6)c5)n4)c3)cc2)cc1 |
| InChI | InChI=1S/C52H36N6/c53-45-30-28-36(29-31-45)35-24-26-37(27-25-35)40-16-9-19-43(32-40)50-55-49(38-12-3-1-4-13-38)56-51(57-50)44-20-10-17-41(33-44)42-18-11-21-46(34-42)58-48-23-8-7-22-47(48)54-52(58)39-14-5-2-6-15-39/h1-34H,53H2 |
| InChIKey | OLDKLJLSTZFPDA-UHFFFAOYSA-N |
| XLogP | 12.46 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.90 |
| LogP ≤ 5 | 12.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|