C9H10ClN3 — CID 676618
1-(2-chloroethyl)-2-methylimidazo[4,5-c]pyridine (PubChem CID 676618) has the molecular formula C9H10ClN3 and a molecular weight of 195.65 g/mol. Its IUPAC name is 1-(2-chloroethyl)-2-methylimidazo[4,5-c]pyridine.
| Compound Name | 1-(2-chloroethyl)-2-methylimidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 676618 |
| Molecular Formula | C9H10ClN3 |
| Molecular Weight | 195.65 g/mol |
| Exact Mass | 195.06 |
| IUPAC Name | 1-(2-chloroethyl)-2-methylimidazo[4,5-c]pyridine |
| SMILES | Cc1nc2cnccc2n1CCCl |
| InChI | InChI=1S/C9H10ClN3/c1-7-12-8-6-11-4-2-9(8)13(7)5-3-10/h2,4,6H,3,5H2,1H3 |
| InChIKey | DNBFSCUFCSGQSC-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.65 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|