C16H10Cl2F3N3O2 — CID 143210801
5,6-dichloro-1-[(4-nitrophenyl)methyl]-2-(1,1,2-trifluoroethyl)benzimidazole (PubChem CID 143210801) has the molecular formula C16H10Cl2F3N3O2 and a molecular weight of 404.18 g/mol. Its IUPAC name is 5,6-dichloro-1-[(4-nitrophenyl)methyl]-2-(1,1,2-trifluoroethyl)benzimidazole.
| Compound Name | 5,6-dichloro-1-[(4-nitrophenyl)methyl]-2-(1,1,2-trifluoroethyl)benzimidazole |
|---|---|
| PubChem CID | 143210801 |
| Molecular Formula | C16H10Cl2F3N3O2 |
| Molecular Weight | 404.18 g/mol |
| Exact Mass | 403.01 |
| IUPAC Name | 5,6-dichloro-1-[(4-nitrophenyl)methyl]-2-(1,1,2-trifluoroethyl)benzimidazole |
| SMILES | O=[N+]([O-])c1ccc(Cn2c(C(F)(F)CF)nc3cc(Cl)c(Cl)cc32)cc1 |
| InChI | InChI=1S/C16H10Cl2F3N3O2/c17-11-5-13-14(6-12(11)18)23(15(22-13)16(20,21)8-19)7-9-1-3-10(4-2-9)24(25)26/h1-6H,7-8H2 |
| InChIKey | QHHAIAWMUIVDQU-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 60.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.18 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|