C12H8N4O3 — CID 70057334
6-(3-nitrophenyl)-7H-imidazo[1,2-a]pyrazin-8-one (PubChem CID 70057334) has the molecular formula C12H8N4O3 and a molecular weight of 256.22 g/mol. Its IUPAC name is 6-(3-nitrophenyl)-7H-imidazo[1,2-a]pyrazin-8-one.
| Compound Name | 6-(3-nitrophenyl)-7H-imidazo[1,2-a]pyrazin-8-one |
|---|---|
| PubChem CID | 70057334 |
| Molecular Formula | C12H8N4O3 |
| Molecular Weight | 256.22 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | 6-(3-nitrophenyl)-7H-imidazo[1,2-a]pyrazin-8-one |
| SMILES | O=c1[nH]c(-c2cccc([N+](=O)[O-])c2)cn2ccnc12 |
| InChI | InChI=1S/C12H8N4O3/c17-12-11-13-4-5-15(11)7-10(14-12)8-2-1-3-9(6-8)16(18)19/h1-7H,(H,14,17) |
| InChIKey | MJYIBBMCMOUDBC-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 93.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.22 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|