C21H15N5O3 — CID 135904316
2-(2,3-dihydroindol-1-yl)-5-(3-nitrophenyl)-3H-pyrido[2,3-d]pyrimidin-4-one (PubChem CID 135904316) has the molecular formula C21H15N5O3 and a molecular weight of 385.38 g/mol. Its IUPAC name is 2-(2,3-dihydroindol-1-yl)-5-(3-nitrophenyl)-3H-pyrido[2,3-d]pyrimidin-4-one.
| Compound Name | 2-(2,3-dihydroindol-1-yl)-5-(3-nitrophenyl)-3H-pyrido[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135904316 |
| Molecular Formula | C21H15N5O3 |
| Molecular Weight | 385.38 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | 2-(2,3-dihydroindol-1-yl)-5-(3-nitrophenyl)-3H-pyrido[2,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(N2CCc3ccccc32)nc2nccc(-c3cccc([N+](=O)[O-])c3)c12 |
| InChI | InChI=1S/C21H15N5O3/c27-20-18-16(14-5-3-6-15(12-14)26(28)29)8-10-22-19(18)23-21(24-20)25-11-9-13-4-1-2-7-17(13)25/h1-8,10,12H,9,11H2,(H,22,23,24,27) |
| InChIKey | XLJIXSYKDRNSSR-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 105.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.38 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|