C17H12N6O2 — CID 58278225
4-[2-(3-nitrophenyl)imidazo[1,2-a]pyridin-3-yl]pyrimidin-2-amine (PubChem CID 58278225) has the molecular formula C17H12N6O2 and a molecular weight of 332.32 g/mol. Its IUPAC name is 4-[2-(3-nitrophenyl)imidazo[1,2-a]pyridin-3-yl]pyrimidin-2-amine.
| Compound Name | 4-[2-(3-nitrophenyl)imidazo[1,2-a]pyridin-3-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 58278225 |
| Molecular Formula | C17H12N6O2 |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 4-[2-(3-nitrophenyl)imidazo[1,2-a]pyridin-3-yl]pyrimidin-2-amine |
| SMILES | Nc1nccc(-c2c(-c3cccc([N+](=O)[O-])c3)nc3ccccn23)n1 |
| InChI | InChI=1S/C17H12N6O2/c18-17-19-8-7-13(20-17)16-15(21-14-6-1-2-9-22(14)16)11-4-3-5-12(10-11)23(24)25/h1-10H,(H2,18,19,20) |
| InChIKey | QFOMIIDLPYHIDN-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 112.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|