C20H12Cl2N4O2 — CID 1124710
1-(2,4-dichlorophenyl)-N-[2-(3-nitrophenyl)imidazo[1,2-a]pyridin-3-yl]methanimine (PubChem CID 1124710) has the molecular formula C20H12Cl2N4O2 and a molecular weight of 411.25 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-N-[2-(3-nitrophenyl)imidazo[1,2-a]pyridin-3-yl]methanimine.
| Compound Name | 1-(2,4-dichlorophenyl)-N-[2-(3-nitrophenyl)imidazo[1,2-a]pyridin-3-yl]methanimine |
|---|---|
| PubChem CID | 1124710 |
| Molecular Formula | C20H12Cl2N4O2 |
| Molecular Weight | 411.25 g/mol |
| Exact Mass | 410.03 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-N-[2-(3-nitrophenyl)imidazo[1,2-a]pyridin-3-yl]methanimine |
| SMILES | O=[N+]([O-])c1cccc(-c2nc3ccccn3c2N=Cc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C20H12Cl2N4O2/c21-15-8-7-14(17(22)11-15)12-23-20-19(24-18-6-1-2-9-25(18)20)13-4-3-5-16(10-13)26(27)28/h1-12H |
| InChIKey | WZWBBRMHTNDOGZ-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.25 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|