C17H17N4O5+ — CID 78578245
1-(3-methoxypropyl)-5-(3-nitrophenyl)pyrido[2,3-d]pyrimidin-8-ium-2,4-dione (PubChem CID 78578245) has the molecular formula C17H17N4O5+ and a molecular weight of 357.35 g/mol. Its IUPAC name is 1-(3-methoxypropyl)-5-(3-nitrophenyl)pyrido[2,3-d]pyrimidin-8-ium-2,4-dione.
| Compound Name | 1-(3-methoxypropyl)-5-(3-nitrophenyl)pyrido[2,3-d]pyrimidin-8-ium-2,4-dione |
|---|---|
| PubChem CID | 78578245 |
| Molecular Formula | C17H17N4O5+ |
| Molecular Weight | 357.35 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 1-(3-methoxypropyl)-5-(3-nitrophenyl)pyrido[2,3-d]pyrimidin-8-ium-2,4-dione |
| SMILES | COCCCn1c(=O)[nH]c(=O)c2c(-c3cccc([N+](=O)[O-])c3)cc[nH+]c21 |
| InChI | InChI=1S/C17H16N4O5/c1-26-9-3-8-20-15-14(16(22)19-17(20)23)13(6-7-18-15)11-4-2-5-12(10-11)21(24)25/h2,4-7,10H,3,8-9H2,1H3,(H,19,22,23)/p+1 |
| InChIKey | ZIHXKINISPBYPS-UHFFFAOYSA-O |
| XLogP | 1.12 |
| TPSA | 121.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.35 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|