C25H26N8O2 — CID 54172816
8-butyl-3-ethyl-7-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]purine-2,6-dione (PubChem CID 54172816) has the molecular formula C25H26N8O2 and a molecular weight of 470.54 g/mol. Its IUPAC name is 8-butyl-3-ethyl-7-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]purine-2,6-dione.
| Compound Name | 8-butyl-3-ethyl-7-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]purine-2,6-dione |
|---|---|
| PubChem CID | 54172816 |
| Molecular Formula | C25H26N8O2 |
| Molecular Weight | 470.54 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | 8-butyl-3-ethyl-7-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]purine-2,6-dione |
| SMILES | CCCCc1nc2c(c(=O)[nH]c(=O)n2CC)n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C25H26N8O2/c1-3-5-10-20-26-23-21(24(34)27-25(35)32(23)4-2)33(20)15-16-11-13-17(14-12-16)18-8-6-7-9-19(18)22-28-30-31-29-22/h6-9,11-14H,3-5,10,15H2,1-2H3,(H,27,34,35)(H,28,29,30,31) |
| InChIKey | OWFBXAKJXGZZJO-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 127.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.54 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |