C30H28N8O2 — CID 54039570
8-pentyl-3-phenyl-7-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]purine-2,6-dione (PubChem CID 54039570) has the molecular formula C30H28N8O2 and a molecular weight of 532.61 g/mol. Its IUPAC name is 8-pentyl-3-phenyl-7-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]purine-2,6-dione.
| Compound Name | 8-pentyl-3-phenyl-7-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]purine-2,6-dione |
|---|---|
| PubChem CID | 54039570 |
| Molecular Formula | C30H28N8O2 |
| Molecular Weight | 532.61 g/mol |
| Exact Mass | 532.23 |
| IUPAC Name | 8-pentyl-3-phenyl-7-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]purine-2,6-dione |
| SMILES | CCCCCc1nc2c(c(=O)[nH]c(=O)n2-c2ccccc2)n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C30H28N8O2/c1-2-3-5-14-25-31-28-26(29(39)32-30(40)38(28)22-10-6-4-7-11-22)37(25)19-20-15-17-21(18-16-20)23-12-8-9-13-24(23)27-33-35-36-34-27/h4,6-13,15-18H,2-3,5,14,19H2,1H3,(H,32,39,40)(H,33,34,35,36) |
| InChIKey | LLJUQSXVFGEPPL-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 127.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.61 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|