C27H22N8O2 — CID 67911268
8-ethyl-1-phenyl-7-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-3H-purine-2,6-dione (PubChem CID 67911268) has the molecular formula C27H22N8O2 and a molecular weight of 490.53 g/mol. Its IUPAC name is 8-ethyl-1-phenyl-7-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-3H-purine-2,6-dione.
| Compound Name | 8-ethyl-1-phenyl-7-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-3H-purine-2,6-dione |
|---|---|
| PubChem CID | 67911268 |
| Molecular Formula | C27H22N8O2 |
| Molecular Weight | 490.53 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | 8-ethyl-1-phenyl-7-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-3H-purine-2,6-dione |
| SMILES | CCc1nc2[nH]c(=O)n(-c3ccccc3)c(=O)c2n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C27H22N8O2/c1-2-22-28-25-23(26(36)35(27(37)29-25)19-8-4-3-5-9-19)34(22)16-17-12-14-18(15-13-17)20-10-6-7-11-21(20)24-30-32-33-31-24/h3-15H,2,16H2,1H3,(H,29,37)(H,30,31,32,33) |
| InChIKey | MCTTYASCXFLQLS-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 127.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.53 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |