C25H26N6O3 — CID 122418820
8-[4-(1H-benzimidazol-2-ylmethoxy)phenyl]-1,3-dipropyl-7H-purine-2,6-dione (PubChem CID 122418820) has the molecular formula C25H26N6O3 and a molecular weight of 458.52 g/mol. Its IUPAC name is 8-[4-(1H-benzimidazol-2-ylmethoxy)phenyl]-1,3-dipropyl-7H-purine-2,6-dione.
| Compound Name | 8-[4-(1H-benzimidazol-2-ylmethoxy)phenyl]-1,3-dipropyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 122418820 |
| Molecular Formula | C25H26N6O3 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | 8-[4-(1H-benzimidazol-2-ylmethoxy)phenyl]-1,3-dipropyl-7H-purine-2,6-dione |
| SMILES | CCCn1c(=O)c2[nH]c(-c3ccc(OCc4nc5ccccc5[nH]4)cc3)nc2n(CCC)c1=O |
| InChI | InChI=1S/C25H26N6O3/c1-3-13-30-23-21(24(32)31(14-4-2)25(30)33)28-22(29-23)16-9-11-17(12-10-16)34-15-20-26-18-7-5-6-8-19(18)27-20/h5-12H,3-4,13-15H2,1-2H3,(H,26,27)(H,28,29) |
| InChIKey | YSADOVZNYIJGBS-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 110.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |