C17H17N5O2 — CID 10980237
2-[4-(1-butyl-2,6-dioxo-3,7-dihydropurin-8-yl)phenyl]acetonitrile (PubChem CID 10980237) has the molecular formula C17H17N5O2 and a molecular weight of 323.36 g/mol. Its IUPAC name is 2-[4-(1-butyl-2,6-dioxo-3,7-dihydropurin-8-yl)phenyl]acetonitrile.
| Compound Name | 2-[4-(1-butyl-2,6-dioxo-3,7-dihydropurin-8-yl)phenyl]acetonitrile |
|---|---|
| PubChem CID | 10980237 |
| Molecular Formula | C17H17N5O2 |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | 2-[4-(1-butyl-2,6-dioxo-3,7-dihydropurin-8-yl)phenyl]acetonitrile |
| SMILES | CCCCn1c(=O)[nH]c2nc(-c3ccc(CC#N)cc3)[nH]c2c1=O |
| InChI | InChI=1S/C17H17N5O2/c1-2-3-10-22-16(23)13-15(21-17(22)24)20-14(19-13)12-6-4-11(5-7-12)8-9-18/h4-7H,2-3,8,10H2,1H3,(H,19,20)(H,21,24) |
| InChIKey | UFQRMJUUVFHWTM-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 107.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |