C14H16N4O4 — CID 19699164
6-amino-1-[3-(4-methoxyphenyl)propyl]-5-nitrosopyrimidine-2,4-dione (PubChem CID 19699164) has the molecular formula C14H16N4O4 and a molecular weight of 304.31 g/mol. Its IUPAC name is 6-amino-1-[3-(4-methoxyphenyl)propyl]-5-nitrosopyrimidine-2,4-dione.
| Compound Name | 6-amino-1-[3-(4-methoxyphenyl)propyl]-5-nitrosopyrimidine-2,4-dione |
|---|---|
| PubChem CID | 19699164 |
| Molecular Formula | C14H16N4O4 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 6-amino-1-[3-(4-methoxyphenyl)propyl]-5-nitrosopyrimidine-2,4-dione |
| SMILES | COc1ccc(CCCn2c(N)c(N=O)c(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C14H16N4O4/c1-22-10-6-4-9(5-7-10)3-2-8-18-12(15)11(17-21)13(19)16-14(18)20/h4-7H,2-3,8,15H2,1H3,(H,16,19,20) |
| InChIKey | PCMIVIHGNCLXRW-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 119.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |