C14H11BrN2O3 — CID 58333129
5-(2-bromoethynyl)-1-[(4-methoxyphenyl)methyl]pyrimidine-2,4-dione (PubChem CID 58333129) has the molecular formula C14H11BrN2O3 and a molecular weight of 335.16 g/mol. Its IUPAC name is 5-(2-bromoethynyl)-1-[(4-methoxyphenyl)methyl]pyrimidine-2,4-dione.
| Compound Name | 5-(2-bromoethynyl)-1-[(4-methoxyphenyl)methyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 58333129 |
| Molecular Formula | C14H11BrN2O3 |
| Molecular Weight | 335.16 g/mol |
| Exact Mass | 334.00 |
| IUPAC Name | 5-(2-bromoethynyl)-1-[(4-methoxyphenyl)methyl]pyrimidine-2,4-dione |
| SMILES | COc1ccc(Cn2cc(C#CBr)c(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C14H11BrN2O3/c1-20-12-4-2-10(3-5-12)8-17-9-11(6-7-15)13(18)16-14(17)19/h2-5,9H,8H2,1H3,(H,16,18,19) |
| InChIKey | SGDZBWIBHCBLQL-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.16 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|