C15H27N3O3 — CID 138657795
1-heptyl-3-(2-methylbutan-2-yl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 138657795) has the molecular formula C15H27N3O3 and a molecular weight of 297.40 g/mol. Its IUPAC name is 1-heptyl-3-(2-methylbutan-2-yl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-heptyl-3-(2-methylbutan-2-yl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 138657795 |
| Molecular Formula | C15H27N3O3 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | 1-heptyl-3-(2-methylbutan-2-yl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | CCCCCCCn1c(=O)[nH]c(=O)n(C(C)(C)CC)c1=O |
| InChI | InChI=1S/C15H27N3O3/c1-5-7-8-9-10-11-17-12(19)16-13(20)18(14(17)21)15(3,4)6-2/h5-11H2,1-4H3,(H,16,19,20) |
| InChIKey | VXYLPCXZVRVKJH-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 76.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|