C15H29N3O5Si — CID 172845365
1-[3-(dibutoxymethylsilyl)propyl]-1,3,5-triazinane-2,4,6-trione (PubChem CID 172845365) has the molecular formula C15H29N3O5Si and a molecular weight of 359.50 g/mol. Its IUPAC name is 1-[3-(dibutoxymethylsilyl)propyl]-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-[3-(dibutoxymethylsilyl)propyl]-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 172845365 |
| Molecular Formula | C15H29N3O5Si |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | 1-[3-(dibutoxymethylsilyl)propyl]-1,3,5-triazinane-2,4,6-trione |
| SMILES | CCCCOC(OCCCC)[SiH2]CCCn1c(=O)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C15H29N3O5Si/c1-3-5-9-22-15(23-10-6-4-2)24-11-7-8-18-13(20)16-12(19)17-14(18)21/h15H,3-11,24H2,1-2H3,(H2,16,17,19,20,21) |
| InChIKey | XIPCCIJSCJAYKC-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 106.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|