C27H57N3O9Si3 — CID 154063195
1,3,5-tris[3-(diethoxymethylsilyl)propyl]-1,3,5-triazinane-2,4,6-trione (PubChem CID 154063195) has the molecular formula C27H57N3O9Si3 and a molecular weight of 652.02 g/mol. Its IUPAC name is 1,3,5-tris[3-(diethoxymethylsilyl)propyl]-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1,3,5-tris[3-(diethoxymethylsilyl)propyl]-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 154063195 |
| Molecular Formula | C27H57N3O9Si3 |
| Molecular Weight | 652.02 g/mol |
| Exact Mass | 651.34 |
| IUPAC Name | 1,3,5-tris[3-(diethoxymethylsilyl)propyl]-1,3,5-triazinane-2,4,6-trione |
| SMILES | CCOC(OCC)[SiH2]CCCn1c(=O)n(CCC[SiH2]C(OCC)OCC)c(=O)n(CCC[SiH2]C(OCC)OCC)c1=O |
| InChI | InChI=1S/C27H57N3O9Si3/c1-7-34-25(35-8-2)40-19-13-16-28-22(31)29(17-14-20-41-26(36-9-3)37-10-4)24(33)30(23(28)32)18-15-21-42-27(38-11-5)39-12-6/h25-27H,7-21,40-42H2,1-6H3 |
| InChIKey | NLRUESNOPIPJFM-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 121.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.02 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|