C14H37NO2Si3 — CID 149152613
3-(diethoxymethylsilyl)-N,N-bis(trimethylsilyl)propan-1-amine (PubChem CID 149152613) has the molecular formula C14H37NO2Si3 and a molecular weight of 335.71 g/mol. Its IUPAC name is 3-(diethoxymethylsilyl)-N,N-bis(trimethylsilyl)propan-1-amine.
| Compound Name | 3-(diethoxymethylsilyl)-N,N-bis(trimethylsilyl)propan-1-amine |
|---|---|
| PubChem CID | 149152613 |
| Molecular Formula | C14H37NO2Si3 |
| Molecular Weight | 335.71 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | 3-(diethoxymethylsilyl)-N,N-bis(trimethylsilyl)propan-1-amine |
| SMILES | CCOC(OCC)[SiH2]CCCN([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C14H37NO2Si3/c1-9-16-14(17-10-2)18-13-11-12-15(19(3,4)5)20(6,7)8/h14H,9-13,18H2,1-8H3 |
| InChIKey | DZWHSENNZDUIML-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.71 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|