C29H69NO10Si4 — CID 172801101
N,N-bis[3-(diethoxymethylsilyl)propyl]-1,7-bis(trimethoxysilyl)heptan-4-amine (PubChem CID 172801101) has the molecular formula C29H69NO10Si4 and a molecular weight of 704.21 g/mol. Its IUPAC name is N,N-bis[3-(diethoxymethylsilyl)propyl]-1,7-bis(trimethoxysilyl)heptan-4-amine.
| Compound Name | N,N-bis[3-(diethoxymethylsilyl)propyl]-1,7-bis(trimethoxysilyl)heptan-4-amine |
|---|---|
| PubChem CID | 172801101 |
| Molecular Formula | C29H69NO10Si4 |
| Molecular Weight | 704.21 g/mol |
| Exact Mass | 703.40 |
| IUPAC Name | N,N-bis[3-(diethoxymethylsilyl)propyl]-1,7-bis(trimethoxysilyl)heptan-4-amine |
| SMILES | CCOC(OCC)[SiH2]CCCN(CCC[SiH2]C(OCC)OCC)C(CCC[Si](OC)(OC)OC)CCC[Si](OC)(OC)OC |
| InChI | InChI=1S/C29H69NO10Si4/c1-11-37-28(38-12-2)41-23-17-21-30(22-18-24-42-29(39-13-3)40-14-4)27(19-15-25-43(31-5,32-6)33-7)20-16-26-44(34-8,35-9)36-10/h27-29H,11-26,41-42H2,1-10H3 |
| InChIKey | QWJAOJQNDFIGNV-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 95.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.21 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|