C14H36N2O6Si2 — CID 141251995
1-N',1-N'-bis(3-trimethoxysilylpropyl)ethane-1,1-diamine (PubChem CID 141251995) has the molecular formula C14H36N2O6Si2 and a molecular weight of 384.62 g/mol. Its IUPAC name is 1-N',1-N'-bis(3-trimethoxysilylpropyl)ethane-1,1-diamine.
| Compound Name | 1-N',1-N'-bis(3-trimethoxysilylpropyl)ethane-1,1-diamine |
|---|---|
| PubChem CID | 141251995 |
| Molecular Formula | C14H36N2O6Si2 |
| Molecular Weight | 384.62 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | 1-N',1-N'-bis(3-trimethoxysilylpropyl)ethane-1,1-diamine |
| SMILES | CO[Si](CCCN(CCC[Si](OC)(OC)OC)C(C)N)(OC)OC |
| InChI | InChI=1S/C14H36N2O6Si2/c1-14(15)16(10-8-12-23(17-2,18-3)19-4)11-9-13-24(20-5,21-6)22-7/h14H,8-13,15H2,1-7H3 |
| InChIKey | PICPKWRSAIOMDE-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 84.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.62 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|