C13H12N2O5 — CID 115946521
1-(1,3-benzodioxol-5-yl)-5-ethyl-6-hydroxypyrimidine-2,4-dione (PubChem CID 115946521) has the molecular formula C13H12N2O5 and a molecular weight of 276.25 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-5-ethyl-6-hydroxypyrimidine-2,4-dione.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-5-ethyl-6-hydroxypyrimidine-2,4-dione |
|---|---|
| PubChem CID | 115946521 |
| Molecular Formula | C13H12N2O5 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-5-ethyl-6-hydroxypyrimidine-2,4-dione |
| SMILES | CCc1c(O)n(-c2ccc3c(c2)OCO3)c(=O)[nH]c1=O |
| InChI | InChI=1S/C13H12N2O5/c1-2-8-11(16)14-13(18)15(12(8)17)7-3-4-9-10(5-7)20-6-19-9/h3-5,17H,2,6H2,1H3,(H,14,16,18) |
| InChIKey | XMLYDPIGSPKJKL-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |