C14H16N2O5 — CID 115946249
1-(3,5-dimethoxyphenyl)-5-ethyl-6-hydroxypyrimidine-2,4-dione (PubChem CID 115946249) has the molecular formula C14H16N2O5 and a molecular weight of 292.29 g/mol. Its IUPAC name is 1-(3,5-dimethoxyphenyl)-5-ethyl-6-hydroxypyrimidine-2,4-dione.
| Compound Name | 1-(3,5-dimethoxyphenyl)-5-ethyl-6-hydroxypyrimidine-2,4-dione |
|---|---|
| PubChem CID | 115946249 |
| Molecular Formula | C14H16N2O5 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 1-(3,5-dimethoxyphenyl)-5-ethyl-6-hydroxypyrimidine-2,4-dione |
| SMILES | CCc1c(O)n(-c2cc(OC)cc(OC)c2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C14H16N2O5/c1-4-11-12(17)15-14(19)16(13(11)18)8-5-9(20-2)7-10(6-8)21-3/h5-7,18H,4H2,1-3H3,(H,15,17,19) |
| InChIKey | AKOSUSMVVIVIJM-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |