C13H13ClN2O4 — CID 115946125
1-(5-chloro-2-methoxyphenyl)-5-ethyl-6-hydroxypyrimidine-2,4-dione (PubChem CID 115946125) has the molecular formula C13H13ClN2O4 and a molecular weight of 296.71 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)-5-ethyl-6-hydroxypyrimidine-2,4-dione.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)-5-ethyl-6-hydroxypyrimidine-2,4-dione |
|---|---|
| PubChem CID | 115946125 |
| Molecular Formula | C13H13ClN2O4 |
| Molecular Weight | 296.71 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)-5-ethyl-6-hydroxypyrimidine-2,4-dione |
| SMILES | CCc1c(O)n(-c2cc(Cl)ccc2OC)c(=O)[nH]c1=O |
| InChI | InChI=1S/C13H13ClN2O4/c1-3-8-11(17)15-13(19)16(12(8)18)9-6-7(14)4-5-10(9)20-2/h4-6,18H,3H2,1-2H3,(H,15,17,19) |
| InChIKey | GEESSACUINNWDF-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.71 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |