C11H7FN2O5 — CID 112599046
1-(1,3-benzodioxol-5-yl)-5-fluoro-6-hydroxypyrimidine-2,4-dione (PubChem CID 112599046) has the molecular formula C11H7FN2O5 and a molecular weight of 266.18 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-5-fluoro-6-hydroxypyrimidine-2,4-dione.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-5-fluoro-6-hydroxypyrimidine-2,4-dione |
|---|---|
| PubChem CID | 112599046 |
| Molecular Formula | C11H7FN2O5 |
| Molecular Weight | 266.18 g/mol |
| Exact Mass | 266.03 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-5-fluoro-6-hydroxypyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(-c2ccc3c(c2)OCO3)c(O)c1F |
| InChI | InChI=1S/C11H7FN2O5/c12-8-9(15)13-11(17)14(10(8)16)5-1-2-6-7(3-5)19-4-18-6/h1-3,16H,4H2,(H,13,15,17) |
| InChIKey | CJXGUFNHJHCIFB-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.18 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |