C17H17ClN2O4 — CID 4892005
1-butyl-5-[3-(4-chlorophenyl)prop-2-enoyl]-6-hydroxypyrimidine-2,4-dione (PubChem CID 4892005) has the molecular formula C17H17ClN2O4 and a molecular weight of 348.79 g/mol. Its IUPAC name is 1-butyl-5-[3-(4-chlorophenyl)prop-2-enoyl]-6-hydroxypyrimidine-2,4-dione.
| Compound Name | 1-butyl-5-[3-(4-chlorophenyl)prop-2-enoyl]-6-hydroxypyrimidine-2,4-dione |
|---|---|
| PubChem CID | 4892005 |
| Molecular Formula | C17H17ClN2O4 |
| Molecular Weight | 348.79 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 1-butyl-5-[3-(4-chlorophenyl)prop-2-enoyl]-6-hydroxypyrimidine-2,4-dione |
| SMILES | CCCCn1c(O)c(C(=O)C=Cc2ccc(Cl)cc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C17H17ClN2O4/c1-2-3-10-20-16(23)14(15(22)19-17(20)24)13(21)9-6-11-4-7-12(18)8-5-11/h4-9,23H,2-3,10H2,1H3,(H,19,22,24) |
| InChIKey | JOXXUXCSAXDYOZ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 92.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.79 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|