C20H33N7O4 — CID 55432347
2-[4-[(3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl]piperazin-1-yl]-N-(2-methoxyethyl)acetamide (PubChem CID 55432347) has the molecular formula C20H33N7O4 and a molecular weight of 435.53 g/mol. Its IUPAC name is 2-[4-[(3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl]piperazin-1-yl]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[4-[(3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl]piperazin-1-yl]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 55432347 |
| Molecular Formula | C20H33N7O4 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.26 |
| IUPAC Name | 2-[4-[(3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl]piperazin-1-yl]-N-(2-methoxyethyl)acetamide |
| SMILES | CCCCn1c(=O)[nH]c(=O)c2c1nc(CN1CCN(CC(=O)NCCOC)CC1)n2C |
| InChI | InChI=1S/C20H33N7O4/c1-4-5-7-27-18-17(19(29)23-20(27)30)24(2)15(22-18)13-25-8-10-26(11-9-25)14-16(28)21-6-12-31-3/h4-14H2,1-3H3,(H,21,28)(H,23,29,30) |
| InChIKey | SRJZPQKFGONGAS-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 117.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|