C16H23N7O3S2 — CID 55401996
3-butyl-8-[[5-(2-methoxyethylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-7-methylpurine-2,6-dione (PubChem CID 55401996) has the molecular formula C16H23N7O3S2 and a molecular weight of 425.54 g/mol. Its IUPAC name is 3-butyl-8-[[5-(2-methoxyethylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-7-methylpurine-2,6-dione.
| Compound Name | 3-butyl-8-[[5-(2-methoxyethylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-7-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 55401996 |
| Molecular Formula | C16H23N7O3S2 |
| Molecular Weight | 425.54 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | 3-butyl-8-[[5-(2-methoxyethylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-7-methylpurine-2,6-dione |
| SMILES | CCCCn1c(=O)[nH]c(=O)c2c1nc(CSc1nnc(NCCOC)s1)n2C |
| InChI | InChI=1S/C16H23N7O3S2/c1-4-5-7-23-12-11(13(24)19-15(23)25)22(2)10(18-12)9-27-16-21-20-14(28-16)17-6-8-26-3/h4-9H2,1-3H3,(H,17,20)(H,19,24,25) |
| InChIKey | BYUXJRLQDBKPJC-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 119.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.54 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|