C16H21N7O4S2 — CID 55640063
ethyl N-[5-[(3-butyl-7-methyl-2,6-dioxopurin-8-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]carbamate (PubChem CID 55640063) has the molecular formula C16H21N7O4S2 and a molecular weight of 439.52 g/mol. Its IUPAC name is ethyl N-[5-[(3-butyl-7-methyl-2,6-dioxopurin-8-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]carbamate.
| Compound Name | ethyl N-[5-[(3-butyl-7-methyl-2,6-dioxopurin-8-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]carbamate |
|---|---|
| PubChem CID | 55640063 |
| Molecular Formula | C16H21N7O4S2 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.11 |
| IUPAC Name | ethyl N-[5-[(3-butyl-7-methyl-2,6-dioxopurin-8-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]carbamate |
| SMILES | CCCCn1c(=O)[nH]c(=O)c2c1nc(CSc1nnc(NC(=O)OCC)s1)n2C |
| InChI | InChI=1S/C16H21N7O4S2/c1-4-6-7-23-11-10(12(24)18-14(23)25)22(3)9(17-11)8-28-16-21-20-13(29-16)19-15(26)27-5-2/h4-8H2,1-3H3,(H,18,24,25)(H,19,20,26) |
| InChIKey | ZQIAUSSZXKBSKU-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 136.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|