C14H11N7O5 — CID 47073166
1-[(3,7-dimethyl-2,6-dioxopurin-8-yl)methyl]-5-nitro-2-oxopyridine-3-carbonitrile (PubChem CID 47073166) has the molecular formula C14H11N7O5 and a molecular weight of 357.29 g/mol. Its IUPAC name is 1-[(3,7-dimethyl-2,6-dioxopurin-8-yl)methyl]-5-nitro-2-oxopyridine-3-carbonitrile.
| Compound Name | 1-[(3,7-dimethyl-2,6-dioxopurin-8-yl)methyl]-5-nitro-2-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 47073166 |
| Molecular Formula | C14H11N7O5 |
| Molecular Weight | 357.29 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | 1-[(3,7-dimethyl-2,6-dioxopurin-8-yl)methyl]-5-nitro-2-oxopyridine-3-carbonitrile |
| SMILES | Cn1c(Cn2cc([N+](=O)[O-])cc(C#N)c2=O)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C14H11N7O5/c1-18-9(16-11-10(18)12(22)17-14(24)19(11)2)6-20-5-8(21(25)26)3-7(4-15)13(20)23/h3,5H,6H2,1-2H3,(H,17,22,24) |
| InChIKey | CNLNEYUUXHMBEH-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 161.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.29 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|