C10H7Cl2N3O3 — CID 26263651
1-[[(1S)-2,2-dichlorocyclopropyl]methyl]-5-nitro-2-oxopyridine-3-carbonitrile (PubChem CID 26263651) has the molecular formula C10H7Cl2N3O3 and a molecular weight of 288.09 g/mol. Its IUPAC name is 1-[[(1S)-2,2-dichlorocyclopropyl]methyl]-5-nitro-2-oxopyridine-3-carbonitrile.
| Compound Name | 1-[[(1S)-2,2-dichlorocyclopropyl]methyl]-5-nitro-2-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 26263651 |
| Molecular Formula | C10H7Cl2N3O3 |
| Molecular Weight | 288.09 g/mol |
| Exact Mass | 286.99 |
| IUPAC Name | 1-[[(1S)-2,2-dichlorocyclopropyl]methyl]-5-nitro-2-oxopyridine-3-carbonitrile |
| SMILES | N#Cc1cc([N+](=O)[O-])cn(C[C@@H]2CC2(Cl)Cl)c1=O |
| InChI | InChI=1S/C10H7Cl2N3O3/c11-10(12)2-7(10)4-14-5-8(15(17)18)1-6(3-13)9(14)16/h1,5,7H,2,4H2/t7-/m0/s1 |
| InChIKey | DVZQPRHFSFCMHH-ZETCQYMHSA-N |
| XLogP | 1.82 |
| TPSA | 88.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.09 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|