C14H10FN3O4 — CID 97227082
1-[(2R)-2-(3-fluorophenyl)-2-hydroxyethyl]-5-nitro-2-oxopyridine-3-carbonitrile (PubChem CID 97227082) has the molecular formula C14H10FN3O4 and a molecular weight of 303.25 g/mol. Its IUPAC name is 1-[(2R)-2-(3-fluorophenyl)-2-hydroxyethyl]-5-nitro-2-oxopyridine-3-carbonitrile.
| Compound Name | 1-[(2R)-2-(3-fluorophenyl)-2-hydroxyethyl]-5-nitro-2-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 97227082 |
| Molecular Formula | C14H10FN3O4 |
| Molecular Weight | 303.25 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 1-[(2R)-2-(3-fluorophenyl)-2-hydroxyethyl]-5-nitro-2-oxopyridine-3-carbonitrile |
| SMILES | N#Cc1cc([N+](=O)[O-])cn(C[C@H](O)c2cccc(F)c2)c1=O |
| InChI | InChI=1S/C14H10FN3O4/c15-11-3-1-2-9(4-11)13(19)8-17-7-12(18(21)22)5-10(6-16)14(17)20/h1-5,7,13,19H,8H2/t13-/m0/s1 |
| InChIKey | WDKCEDXPAFEWCC-ZDUSSCGKSA-N |
| XLogP | 1.50 |
| TPSA | 109.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.25 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|