C17H16N4O4 — CID 8632494
2-(3-cyano-5-nitro-2-oxo-1-pyridinyl)-N-methyl-N-[(1R)-1-phenylethyl]acetamide (PubChem CID 8632494) has the molecular formula C17H16N4O4 and a molecular weight of 340.34 g/mol. Its IUPAC name is 2-(3-cyano-5-nitro-2-oxo-1-pyridinyl)-N-methyl-N-[(1R)-1-phenylethyl]acetamide.
| Compound Name | 2-(3-cyano-5-nitro-2-oxo-1-pyridinyl)-N-methyl-N-[(1R)-1-phenylethyl]acetamide |
|---|---|
| PubChem CID | 8632494 |
| Molecular Formula | C17H16N4O4 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 2-(3-cyano-5-nitro-2-oxo-1-pyridinyl)-N-methyl-N-[(1R)-1-phenylethyl]acetamide |
| SMILES | C[C@H](c1ccccc1)N(C)C(=O)Cn1cc([N+](=O)[O-])cc(C#N)c1=O |
| InChI | InChI=1S/C17H16N4O4/c1-12(13-6-4-3-5-7-13)19(2)16(22)11-20-10-15(21(24)25)8-14(9-18)17(20)23/h3-8,10,12H,11H2,1-2H3/t12-/m1/s1 |
| InChIKey | AYWGIZHBXZWQCG-GFCCVEGCSA-N |
| XLogP | 1.85 |
| TPSA | 109.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|