C23H20N4O4 — CID 8632262
N-benzyl-2-(3-cyano-5-nitro-2-oxo-1-pyridinyl)-N-(2-phenylethyl)acetamide (PubChem CID 8632262) has the molecular formula C23H20N4O4 and a molecular weight of 416.44 g/mol. Its IUPAC name is N-benzyl-2-(3-cyano-5-nitro-2-oxo-1-pyridinyl)-N-(2-phenylethyl)acetamide.
| Compound Name | N-benzyl-2-(3-cyano-5-nitro-2-oxo-1-pyridinyl)-N-(2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 8632262 |
| Molecular Formula | C23H20N4O4 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | N-benzyl-2-(3-cyano-5-nitro-2-oxo-1-pyridinyl)-N-(2-phenylethyl)acetamide |
| SMILES | N#Cc1cc([N+](=O)[O-])cn(CC(=O)N(CCc2ccccc2)Cc2ccccc2)c1=O |
| InChI | InChI=1S/C23H20N4O4/c24-14-20-13-21(27(30)31)16-26(23(20)29)17-22(28)25(15-19-9-5-2-6-10-19)12-11-18-7-3-1-4-8-18/h1-10,13,16H,11-12,15,17H2 |
| InChIKey | PDLAJQVLAJQKCB-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 109.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|