C16H15N3O4 — CID 84584582
1-[3-(3-methoxyphenyl)propyl]-5-nitro-2-oxopyridine-3-carbonitrile (PubChem CID 84584582) has the molecular formula C16H15N3O4 and a molecular weight of 313.31 g/mol. Its IUPAC name is 1-[3-(3-methoxyphenyl)propyl]-5-nitro-2-oxopyridine-3-carbonitrile.
| Compound Name | 1-[3-(3-methoxyphenyl)propyl]-5-nitro-2-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 84584582 |
| Molecular Formula | C16H15N3O4 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 1-[3-(3-methoxyphenyl)propyl]-5-nitro-2-oxopyridine-3-carbonitrile |
| SMILES | COc1cccc(CCCn2cc([N+](=O)[O-])cc(C#N)c2=O)c1 |
| InChI | InChI=1S/C16H15N3O4/c1-23-15-6-2-4-12(8-15)5-3-7-18-11-14(19(21)22)9-13(10-17)16(18)20/h2,4,6,8-9,11H,3,5,7H2,1H3 |
| InChIKey | WJEJONWNJUNPCV-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 98.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|