C18H20N6O7 — CID 55561373
methyl 1-[(3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl]-5-nitro-2-oxopyridine-3-carboxylate (PubChem CID 55561373) has the molecular formula C18H20N6O7 and a molecular weight of 432.39 g/mol. Its IUPAC name is methyl 1-[(3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl]-5-nitro-2-oxopyridine-3-carboxylate.
| Compound Name | methyl 1-[(3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl]-5-nitro-2-oxopyridine-3-carboxylate |
|---|---|
| PubChem CID | 55561373 |
| Molecular Formula | C18H20N6O7 |
| Molecular Weight | 432.39 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | methyl 1-[(3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl]-5-nitro-2-oxopyridine-3-carboxylate |
| SMILES | CCCCn1c(=O)[nH]c(=O)c2c1nc(Cn1cc([N+](=O)[O-])cc(C(=O)OC)c1=O)n2C |
| InChI | InChI=1S/C18H20N6O7/c1-4-5-6-23-14-13(15(25)20-18(23)28)21(2)12(19-14)9-22-8-10(24(29)30)7-11(16(22)26)17(27)31-3/h7-8H,4-6,9H2,1-3H3,(H,20,25,28) |
| InChIKey | AGHCMLJTEUCFSM-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 164.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.39 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|