C15H24N4O3 — CID 67735594
8-(8-hydroxyoctyl)-3,7-dimethylpurine-2,6-dione (PubChem CID 67735594) has the molecular formula C15H24N4O3 and a molecular weight of 308.38 g/mol. Its IUPAC name is 8-(8-hydroxyoctyl)-3,7-dimethylpurine-2,6-dione.
| Compound Name | 8-(8-hydroxyoctyl)-3,7-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 67735594 |
| Molecular Formula | C15H24N4O3 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | 8-(8-hydroxyoctyl)-3,7-dimethylpurine-2,6-dione |
| SMILES | Cn1c(CCCCCCCCO)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C15H24N4O3/c1-18-11(9-7-5-3-4-6-8-10-20)16-13-12(18)14(21)17-15(22)19(13)2/h20H,3-10H2,1-2H3,(H,17,21,22) |
| InChIKey | UIFWELIPOUIBAA-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|