C25H40N4O2 — CID 67735435
3,7-dimethyl-8-[(9Z,12Z)-octadeca-9,12-dienyl]purine-2,6-dione (PubChem CID 67735435) has the molecular formula C25H40N4O2 and a molecular weight of 428.62 g/mol. Its IUPAC name is 3,7-dimethyl-8-[(9Z,12Z)-octadeca-9,12-dienyl]purine-2,6-dione.
| Compound Name | 3,7-dimethyl-8-[(9Z,12Z)-octadeca-9,12-dienyl]purine-2,6-dione |
|---|---|
| PubChem CID | 67735435 |
| Molecular Formula | C25H40N4O2 |
| Molecular Weight | 428.62 g/mol |
| Exact Mass | 428.32 |
| IUPAC Name | 3,7-dimethyl-8-[(9Z,12Z)-octadeca-9,12-dienyl]purine-2,6-dione |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCc1nc2c(c(=O)[nH]c(=O)n2C)n1C |
| InChI | InChI=1S/C25H40N4O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-26-23-22(28(21)2)24(30)27-25(31)29(23)3/h8-9,11-12H,4-7,10,13-20H2,1-3H3,(H,27,30,31)/b9-8-,12-11- |
| InChIKey | OZFBNKXMGUOQJT-MURFETPASA-N |
| XLogP | 5.32 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.62 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|