C30H53N5O4 — CID 67650737
N-decyl-N-[11-(3,7-dimethyl-2,6-dioxopurin-8-yl)-2-hydroxyundecyl]acetamide (PubChem CID 67650737) has the molecular formula C30H53N5O4 and a molecular weight of 547.79 g/mol. Its IUPAC name is N-decyl-N-[11-(3,7-dimethyl-2,6-dioxopurin-8-yl)-2-hydroxyundecyl]acetamide.
| Compound Name | N-decyl-N-[11-(3,7-dimethyl-2,6-dioxopurin-8-yl)-2-hydroxyundecyl]acetamide |
|---|---|
| PubChem CID | 67650737 |
| Molecular Formula | C30H53N5O4 |
| Molecular Weight | 547.79 g/mol |
| Exact Mass | 547.41 |
| IUPAC Name | N-decyl-N-[11-(3,7-dimethyl-2,6-dioxopurin-8-yl)-2-hydroxyundecyl]acetamide |
| SMILES | CCCCCCCCCCN(CC(O)CCCCCCCCCc1nc2c(c(=O)[nH]c(=O)n2C)n1C)C(C)=O |
| InChI | InChI=1S/C30H53N5O4/c1-5-6-7-8-9-13-16-19-22-35(24(2)36)23-25(37)20-17-14-11-10-12-15-18-21-26-31-28-27(33(26)3)29(38)32-30(39)34(28)4/h25,37H,5-23H2,1-4H3,(H,32,38,39) |
| InChIKey | BICWQMRPLRVTNP-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 113.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.79 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|