C13H17N5O2 — CID 47370801
8-(2-azabicyclo[2.2.1]heptan-2-yl)-3,7-dimethylpurine-2,6-dione (PubChem CID 47370801) has the molecular formula C13H17N5O2 and a molecular weight of 275.31 g/mol. Its IUPAC name is 8-(2-azabicyclo[2.2.1]heptan-2-yl)-3,7-dimethylpurine-2,6-dione.
| Compound Name | 8-(2-azabicyclo[2.2.1]heptan-2-yl)-3,7-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 47370801 |
| Molecular Formula | C13H17N5O2 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | 8-(2-azabicyclo[2.2.1]heptan-2-yl)-3,7-dimethylpurine-2,6-dione |
| SMILES | Cn1c(N2CC3CCC2C3)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C13H17N5O2/c1-16-9-10(17(2)13(20)15-11(9)19)14-12(16)18-6-7-3-4-8(18)5-7/h7-8H,3-6H2,1-2H3,(H,15,19,20) |
| InChIKey | NMSIRMQERTWBJI-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 75.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |