C10H11BrN4O3 — CID 3126123
8-bromo-3-methyl-7-(3-oxobutan-2-yl)purine-2,6-dione (PubChem CID 3126123) has the molecular formula C10H11BrN4O3 and a molecular weight of 315.13 g/mol. Its IUPAC name is 8-bromo-3-methyl-7-(3-oxobutan-2-yl)purine-2,6-dione.
| Compound Name | 8-bromo-3-methyl-7-(3-oxobutan-2-yl)purine-2,6-dione |
|---|---|
| PubChem CID | 3126123 |
| Molecular Formula | C10H11BrN4O3 |
| Molecular Weight | 315.13 g/mol |
| Exact Mass | 314.00 |
| IUPAC Name | 8-bromo-3-methyl-7-(3-oxobutan-2-yl)purine-2,6-dione |
| SMILES | CC(=O)C(C)n1c(Br)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C10H11BrN4O3/c1-4(5(2)16)15-6-7(12-9(15)11)14(3)10(18)13-8(6)17/h4H,1-3H3,(H,13,17,18) |
| InChIKey | SVSPOEAZYCDBKE-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 89.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.13 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |