C20H15BrN4O3 — CID 3319041
8-bromo-3-methyl-7-(2-oxo-1,2-diphenylethyl)purine-2,6-dione (PubChem CID 3319041) has the molecular formula C20H15BrN4O3 and a molecular weight of 439.27 g/mol. Its IUPAC name is 8-bromo-3-methyl-7-(2-oxo-1,2-diphenylethyl)purine-2,6-dione.
| Compound Name | 8-bromo-3-methyl-7-(2-oxo-1,2-diphenylethyl)purine-2,6-dione |
|---|---|
| PubChem CID | 3319041 |
| Molecular Formula | C20H15BrN4O3 |
| Molecular Weight | 439.27 g/mol |
| Exact Mass | 438.03 |
| IUPAC Name | 8-bromo-3-methyl-7-(2-oxo-1,2-diphenylethyl)purine-2,6-dione |
| SMILES | Cn1c(=O)[nH]c(=O)c2c1nc(Br)n2C(C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H15BrN4O3/c1-24-17-15(18(27)23-20(24)28)25(19(21)22-17)14(12-8-4-2-5-9-12)16(26)13-10-6-3-7-11-13/h2-11,14H,1H3,(H,23,27,28) |
| InChIKey | FORMGPCIPCXORA-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 89.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.27 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |