C13H18N4O4 — CID 82465294
5-(2,6-dioxo-3-propyl-7H-purin-8-yl)pentanoic acid (PubChem CID 82465294) has the molecular formula C13H18N4O4 and a molecular weight of 294.31 g/mol. Its IUPAC name is 5-(2,6-dioxo-3-propyl-7H-purin-8-yl)pentanoic acid.
| Compound Name | 5-(2,6-dioxo-3-propyl-7H-purin-8-yl)pentanoic acid |
|---|---|
| PubChem CID | 82465294 |
| Molecular Formula | C13H18N4O4 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 5-(2,6-dioxo-3-propyl-7H-purin-8-yl)pentanoic acid |
| SMILES | CCCn1c(=O)[nH]c(=O)c2[nH]c(CCCCC(=O)O)nc21 |
| InChI | InChI=1S/C13H18N4O4/c1-2-7-17-11-10(12(20)16-13(17)21)14-8(15-11)5-3-4-6-9(18)19/h2-7H2,1H3,(H,14,15)(H,18,19)(H,16,20,21) |
| InChIKey | ZGPIGSUXKSWWAJ-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 120.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|