C12H16N4O5 — CID 82465406
4-[3-(2-methoxyethyl)-2,6-dioxo-7H-purin-8-yl]butanoic acid (PubChem CID 82465406) has the molecular formula C12H16N4O5 and a molecular weight of 296.28 g/mol. Its IUPAC name is 4-[3-(2-methoxyethyl)-2,6-dioxo-7H-purin-8-yl]butanoic acid.
| Compound Name | 4-[3-(2-methoxyethyl)-2,6-dioxo-7H-purin-8-yl]butanoic acid |
|---|---|
| PubChem CID | 82465406 |
| Molecular Formula | C12H16N4O5 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 4-[3-(2-methoxyethyl)-2,6-dioxo-7H-purin-8-yl]butanoic acid |
| SMILES | COCCn1c(=O)[nH]c(=O)c2[nH]c(CCCC(=O)O)nc21 |
| InChI | InChI=1S/C12H16N4O5/c1-21-6-5-16-10-9(11(19)15-12(16)20)13-7(14-10)3-2-4-8(17)18/h2-6H2,1H3,(H,13,14)(H,17,18)(H,15,19,20) |
| InChIKey | TWKNVCIOYLKLSB-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 130.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |